C13H18ClIN2O2 — CID 119672668
N-(4-iodophenyl)-2-(oxolan-2-ylmethylamino)acetamide;hydrochloride (PubChem CID 119672668) has the molecular formula C13H18ClIN2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-(oxolan-2-ylmethylamino)acetamide;hydrochloride.
| Compound Name | N-(4-iodophenyl)-2-(oxolan-2-ylmethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119672668 |
| Molecular Formula | C13H18ClIN2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | N-(4-iodophenyl)-2-(oxolan-2-ylmethylamino)acetamide;hydrochloride |
| SMILES | Cl.O=C(CNCC1CCCO1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C13H17IN2O2.ClH/c14-10-3-5-11(6-4-10)16-13(17)9-15-8-12-2-1-7-18-12;/h3-6,12,15H,1-2,7-9H2,(H,16,17);1H |
| InChIKey | OILBYCCZBYUHMV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|