C11H16ClIN2O — CID 119672677
N-(4-iodophenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119672677) has the molecular formula C11H16ClIN2O and a molecular weight of 354.62 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-(4-iodophenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119672677 |
| Molecular Formula | C11H16ClIN2O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-(4-iodophenyl)-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1ccc(I)cc1.Cl |
| InChI | InChI=1S/C11H15IN2O.ClH/c1-8(7-13-2)11(15)14-10-5-3-9(12)4-6-10;/h3-6,8,13H,7H2,1-2H3,(H,14,15);1H |
| InChIKey | ZIYYWECRBUPPDY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|