C12H19ClN2O — CID 119672801
2-(methylamino)-N-(4-propan-2-ylphenyl)acetamide;hydrochloride (PubChem CID 119672801) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-(methylamino)-N-(4-propan-2-ylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(methylamino)-N-(4-propan-2-ylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119672801 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(methylamino)-N-(4-propan-2-ylphenyl)acetamide;hydrochloride |
| SMILES | CNCC(=O)Nc1ccc(C(C)C)cc1.Cl |
| InChI | InChI=1S/C12H18N2O.ClH/c1-9(2)10-4-6-11(7-5-10)14-12(15)8-13-3;/h4-7,9,13H,8H2,1-3H3,(H,14,15);1H |
| InChIKey | PHHXEFYGILEWLV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |