C8H14N6O — CID 119676103
3-amino-N-(2H-tetrazol-5-yl)cyclohexane-1-carboxamide (PubChem CID 119676103) has the molecular formula C8H14N6O and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-amino-N-(2H-tetrazol-5-yl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-(2H-tetrazol-5-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119676103 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-amino-N-(2H-tetrazol-5-yl)cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)Nc2nn[nH]n2)C1 |
| InChI | InChI=1S/C8H14N6O/c9-6-3-1-2-5(4-6)7(15)10-8-11-13-14-12-8/h5-6H,1-4,9H2,(H2,10,11,12,13,14,15) |
| InChIKey | PGQDBTOXUKYUSP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |