C14H27ClN2O2 — CID 119676193
N-(2,3-dimethylcyclohexyl)-2-morpholin-2-ylacetamide;hydrochloride (PubChem CID 119676193) has the molecular formula C14H27ClN2O2 and a molecular weight of 290.84 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-morpholin-2-ylacetamide;hydrochloride.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-morpholin-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119676193 |
| Molecular Formula | C14H27ClN2O2 |
| Molecular Weight | 290.84 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-morpholin-2-ylacetamide;hydrochloride |
| SMILES | CC1CCCC(NC(=O)CC2CNCCO2)C1C.Cl |
| InChI | InChI=1S/C14H26N2O2.ClH/c1-10-4-3-5-13(11(10)2)16-14(17)8-12-9-15-6-7-18-12;/h10-13,15H,3-9H2,1-2H3,(H,16,17);1H |
| InChIKey | PWIDYEYTKIQEGF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |