C40H38N4 — CID 11967745
(4R,5R)-2-[3-tert-butyl-5-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole (PubChem CID 11967745) has the molecular formula C40H38N4 and a molecular weight of 574.77 g/mol. Its IUPAC name is (4R,5R)-2-[3-tert-butyl-5-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5R)-2-[3-tert-butyl-5-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11967745 |
| Molecular Formula | C40H38N4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | (4R,5R)-2-[3-tert-butyl-5-[(4R,5R)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]phenyl]-4,5-diphenyl-4,5-dihydro-1H-imidazole |
| SMILES | CC(C)(C)c1cc(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2)cc(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)N2)c1 |
| InChI | InChI=1S/C40H38N4/c1-40(2,3)33-25-31(38-41-34(27-16-8-4-9-17-27)35(42-38)28-18-10-5-11-19-28)24-32(26-33)39-43-36(29-20-12-6-13-21-29)37(44-39)30-22-14-7-15-23-30/h4-26,34-37H,1-3H3,(H,41,42)(H,43,44)/t34-,35-,36-,37-/m1/s1 |
| InChIKey | ACDCYNAVWMRILC-LPYGTTGFSA-N |
| XLogP | 8.65 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |