C19H24ClN3O3 — CID 119679544
N-benzyl-2-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride (PubChem CID 119679544) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-benzyl-2-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride.
| Compound Name | N-benzyl-2-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119679544 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-benzyl-2-[[2-(2-methoxyethylamino)acetyl]amino]benzamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccccc1C(=O)NCc1ccccc1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-25-12-11-20-14-18(23)22-17-10-6-5-9-16(17)19(24)21-13-15-7-3-2-4-8-15;/h2-10,20H,11-14H2,1H3,(H,21,24)(H,22,23);1H |
| InChIKey | BVKVHBMUVVKGFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|