C13H16 — CID 11968007
(1Z,7Z,8Z,10Z)-bicyclo[5.4.2]trideca-1(12),7(13),8,10-tetraene (PubChem CID 11968007) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (1Z,7Z,8Z,10Z)-bicyclo[5.4.2]trideca-1(12),7(13),8,10-tetraene.
| Compound Name | (1Z,7Z,8Z,10Z)-bicyclo[5.4.2]trideca-1(12),7(13),8,10-tetraene |
|---|---|
| PubChem CID | 11968007 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (1Z,7Z,8Z,10Z)-bicyclo[5.4.2]trideca-1(12),7(13),8,10-tetraene |
| SMILES | C1=C\C2=C/C=C(\C=C/1)CCCCC2 |
| InChI | InChI=1S/C13H16/c1-2-6-12-8-4-5-9-13(7-3-1)11-10-12/h4-5,8-11H,1-3,6-7H2/b5-4-,8-4-,9-5-,11-10-,12-8-,12-10-,13-9-,13-11- |
| InChIKey | XRXWAKCPFJMTBC-VBKZNOIUSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |