C18H34ClN3O2 — CID 119682320
2-morpholin-2-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide;hydrochloride (PubChem CID 119682320) has the molecular formula C18H34ClN3O2 and a molecular weight of 359.94 g/mol. Its IUPAC name is 2-morpholin-2-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide;hydrochloride.
| Compound Name | 2-morpholin-2-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119682320 |
| Molecular Formula | C18H34ClN3O2 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-morpholin-2-yl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CNCCO1)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C18H33N3O2.ClH/c22-17(13-16-14-19-9-12-23-16)20-15-18(7-3-1-4-8-18)21-10-5-2-6-11-21;/h16,19H,1-15H2,(H,20,22);1H |
| InChIKey | LMLZMFOQHSPESL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |