C21H30O13 — CID 11968362
[(2R,3R,4R,5R)-5,6-dihydroxy-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 11968362) has the molecular formula C21H30O13 and a molecular weight of 490.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5,6-dihydroxy-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | [(2R,3R,4R,5R)-5,6-dihydroxy-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 11968362 |
| Molecular Formula | C21H30O13 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5,6-dihydroxy-2-(hydroxymethyl)-4-[(2S,3R,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] 3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](OC(=O)CCc3ccc(O)c(O)c3)[C@@H](CO)OC(O)[C@@H]2O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30O13/c1-8-14(26)15(27)16(28)21(31-8)34-19-17(29)20(30)32-12(7-22)18(19)33-13(25)5-3-9-2-4-10(23)11(24)6-9/h2,4,6,8,12,14-24,26-30H,3,5,7H2,1H3/t8-,12+,14+,15+,16+,17+,18+,19+,20?,21-/m0/s1 |
| InChIKey | HVAKBFZHBXGTJU-BYJQROIYSA-N |
| XLogP | -2.77 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|