C12H22ClN3O3 — CID 119685230
1-(2-morpholin-2-ylacetyl)piperidine-2-carboxamide;hydrochloride (PubChem CID 119685230) has the molecular formula C12H22ClN3O3 and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(2-morpholin-2-ylacetyl)piperidine-2-carboxamide;hydrochloride.
| Compound Name | 1-(2-morpholin-2-ylacetyl)piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119685230 |
| Molecular Formula | C12H22ClN3O3 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-(2-morpholin-2-ylacetyl)piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCCCN1C(=O)CC1CNCCO1 |
| InChI | InChI=1S/C12H21N3O3.ClH/c13-12(17)10-3-1-2-5-15(10)11(16)7-9-8-14-4-6-18-9;/h9-10,14H,1-8H2,(H2,13,17);1H |
| InChIKey | PGYINXGPNLQDOM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |