C17H25N3O2 — CID 119685393
3-[(3-aminocyclopentanecarbonyl)amino]-N,N-diethylbenzamide (PubChem CID 119685393) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-[(3-aminocyclopentanecarbonyl)amino]-N,N-diethylbenzamide.
| Compound Name | 3-[(3-aminocyclopentanecarbonyl)amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 119685393 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-[(3-aminocyclopentanecarbonyl)amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)C2CCC(N)C2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-20(4-2)17(22)13-6-5-7-15(11-13)19-16(21)12-8-9-14(18)10-12/h5-7,11-12,14H,3-4,8-10,18H2,1-2H3,(H,19,21) |
| InChIKey | JQEIQHPCKQCBSX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |