C16H29ClN2O — CID 119686901
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(3-aminocyclohexyl)methanone;hydrochloride (PubChem CID 119686901) has the molecular formula C16H29ClN2O and a molecular weight of 300.87 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(3-aminocyclohexyl)methanone;hydrochloride.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(3-aminocyclohexyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119686901 |
| Molecular Formula | C16H29ClN2O |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(3-aminocyclohexyl)methanone;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)N2CCCC3CCCCC32)C1 |
| InChI | InChI=1S/C16H28N2O.ClH/c17-14-8-3-6-13(11-14)16(19)18-10-4-7-12-5-1-2-9-15(12)18;/h12-15H,1-11,17H2;1H |
| InChIKey | SSOHMAYNKZMZFG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |