C20H25ClN2O — CID 119686987
3-amino-N-(1-naphthalen-1-ylethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride (PubChem CID 119686987) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 3-amino-N-(1-naphthalen-1-ylethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(1-naphthalen-1-ylethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119686987 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-amino-N-(1-naphthalen-1-ylethyl)bicyclo[2.2.1]heptane-2-carboxamide;hydrochloride |
| SMILES | CC(NC(=O)C1C2CCC(C2)C1N)c1cccc2ccccc12.Cl |
| InChI | InChI=1S/C20H24N2O.ClH/c1-12(16-8-4-6-13-5-2-3-7-17(13)16)22-20(23)18-14-9-10-15(11-14)19(18)21;/h2-8,12,14-15,18-19H,9-11,21H2,1H3,(H,22,23);1H |
| InChIKey | RNBZWMHXEFPTBT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |