C14H18ClN5OS — CID 119688580
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119688580) has the molecular formula C14H18ClN5OS and a molecular weight of 339.85 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119688580 |
| Molecular Formula | C14H18ClN5OS |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C14H18ClN5OS/c1-19(8-11-2-3-13(15)22-11)14(21)12-9-20(18-17-12)10-4-6-16-7-5-10/h2-3,9-10,16H,4-8H2,1H3 |
| InChIKey | YYCUGDXMCHZPEH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |