About 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride
2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride (PubChem CID 119688873) has the molecular formula C13H23ClN4O
and a molecular weight of 286.81 g/mol. Its IUPAC name is 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride |
| PubChem CID | 119688873 |
| Molecular Formula | C13H23ClN4O |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride |
| SMILES | Cc1nn(C)c(C)c1NC(=O)CC1CCNCC1.Cl |
| InChI | InChI=1S/C13H22N4O.ClH/c1-9-13(10(2)17(3)16-9)15-12(18)8-11-4-6-14-7-5-11;/h11,14H,4-8H2,1-3H3,(H,15,18);1H |
| InChIKey | XGBWCBQUZNEYFN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride?
The IUPAC name of 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride (CID 119688873) is 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride?
The canonical SMILES for 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride is Cc1nn(C)c(C)c1NC(=O)CC1CCNCC1.Cl.
What is the InChIKey of 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride?
The InChIKey is XGBWCBQUZNEYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O.ClH/c1-9-13(10(2)17(3)16-9)15-12(18)8-11-4-6-14-7-5-11;/h11,14H,4-8H2,1-3H3,(H,15,18);1H.
What are the key properties of 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride?
2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride has a molecular weight of 286.81 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-N-(1,3,5-trimethylpyrazol-4-yl)acetamide;hydrochloride is sourced from PubChem (CID 119688873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).