C10H20ClN3O2 — CID 119689244
(2R)-N-[2-(dimethylamino)-2-oxoethyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119689244) has the molecular formula C10H20ClN3O2 and a molecular weight of 249.74 g/mol. Its IUPAC name is (2R)-N-[2-(dimethylamino)-2-oxoethyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[2-(dimethylamino)-2-oxoethyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119689244 |
| Molecular Formula | C10H20ClN3O2 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (2R)-N-[2-(dimethylamino)-2-oxoethyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CN(C)C(=O)CNC(=O)[C@H]1CCCCN1.Cl |
| InChI | InChI=1S/C10H19N3O2.ClH/c1-13(2)9(14)7-12-10(15)8-5-3-4-6-11-8;/h8,11H,3-7H2,1-2H3,(H,12,15);1H/t8-;/m1./s1 |
| InChIKey | SOGUJHJSTCFTSG-DDWIOCJRSA-N |
| XLogP | -0.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |