C18H23ClN2O — CID 119689331
3-amino-N-(3-methyl-1-phenylbutyl)benzamide;hydrochloride (PubChem CID 119689331) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 3-amino-N-(3-methyl-1-phenylbutyl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(3-methyl-1-phenylbutyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119689331 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 3-amino-N-(3-methyl-1-phenylbutyl)benzamide;hydrochloride |
| SMILES | CC(C)CC(NC(=O)c1cccc(N)c1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H22N2O.ClH/c1-13(2)11-17(14-7-4-3-5-8-14)20-18(21)15-9-6-10-16(19)12-15;/h3-10,12-13,17H,11,19H2,1-2H3,(H,20,21);1H |
| InChIKey | QHYDXAYOSXQRJZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|