C15H24N4O3S — CID 119689801
N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 119689801) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119689801 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(dimethylamino)-5-(dimethylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)N(C)C)cc1NC(=O)C1CCNC1 |
| InChI | InChI=1S/C15H24N4O3S/c1-18(2)14-6-5-12(23(21,22)19(3)4)9-13(14)17-15(20)11-7-8-16-10-11/h5-6,9,11,16H,7-8,10H2,1-4H3,(H,17,20) |
| InChIKey | YIMNJARWXLXUTH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |