C17H30ClN3O3S — CID 119691062
(2S)-2-amino-N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-methylpentanamide;hydrochloride (PubChem CID 119691062) has the molecular formula C17H30ClN3O3S and a molecular weight of 391.97 g/mol. Its IUPAC name is (2S)-2-amino-N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119691062 |
| Molecular Formula | C17H30ClN3O3S |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-2-amino-N-[[4-(diethylsulfamoyl)phenyl]methyl]-4-methylpentanamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)[C@@H](N)CC(C)C)cc1.Cl |
| InChI | InChI=1S/C17H29N3O3S.ClH/c1-5-20(6-2)24(22,23)15-9-7-14(8-10-15)12-19-17(21)16(18)11-13(3)4;/h7-10,13,16H,5-6,11-12,18H2,1-4H3,(H,19,21);1H/t16-;/m0./s1 |
| InChIKey | MZBHXVMUDGZKDH-NTISSMGPSA-N |
| XLogP | 2.13 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |