C17H27ClN2OS — CID 119691430
N-(2-phenylsulfanylethyl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119691430) has the molecular formula C17H27ClN2OS and a molecular weight of 342.94 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-(2-phenylsulfanylethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119691430 |
| Molecular Formula | C17H27ClN2OS |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCSc1ccccc1)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H26N2OS.ClH/c1-14(15-7-9-18-10-8-15)13-17(20)19-11-12-21-16-5-3-2-4-6-16;/h2-6,14-15,18H,7-13H2,1H3,(H,19,20);1H |
| InChIKey | JFWLOVDARUDJMU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|