C22H26N4OS — CID 119691524
(2S)-2-amino-3-(1-benzylimidazol-4-yl)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide (PubChem CID 119691524) has the molecular formula C22H26N4OS and a molecular weight of 394.54 g/mol. Its IUPAC name is (2S)-2-amino-3-(1-benzylimidazol-4-yl)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide.
| Compound Name | (2S)-2-amino-3-(1-benzylimidazol-4-yl)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 119691524 |
| Molecular Formula | C22H26N4OS |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | (2S)-2-amino-3-(1-benzylimidazol-4-yl)-N-[2-(4-methylphenyl)sulfanylethyl]propanamide |
| SMILES | Cc1ccc(SCCNC(=O)[C@@H](N)Cc2cn(Cc3ccccc3)cn2)cc1 |
| InChI | InChI=1S/C22H26N4OS/c1-17-7-9-20(10-8-17)28-12-11-24-22(27)21(23)13-19-15-26(16-25-19)14-18-5-3-2-4-6-18/h2-10,15-16,21H,11-14,23H2,1H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | QGXBGYDFEKUXFA-NRFANRHFSA-N |
| XLogP | 3.02 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|