C20H25ClN2O3 — CID 119693376
2-(4-aminophenyl)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]ethanone;hydrochloride (PubChem CID 119693376) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119693376 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-(4-aminophenyl)-1-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]ethanone;hydrochloride |
| SMILES | COc1ccc(C2CCCN2C(=O)Cc2ccc(N)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C20H24N2O3.ClH/c1-24-16-9-10-17(19(13-16)25-2)18-4-3-11-22(18)20(23)12-14-5-7-15(21)8-6-14;/h5-10,13,18H,3-4,11-12,21H2,1-2H3;1H |
| InChIKey | ZMQIZFUOZDFUCO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|