About (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide
(2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide (PubChem CID 119694692) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide |
| PubChem CID | 119694692 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide |
| SMILES | CCc1oc2ccccc2c1CN(C)C(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C18H26N2O2/c1-5-16-14(13-8-6-7-9-17(13)22-16)11-20(4)18(21)15(19)10-12(2)3/h6-9,12,15H,5,10-11,19H2,1-4H3/t15-/m0/s1 |
| InChIKey | JICDNUIJFXRFME-HNNXBMFYSA-N |
| XLogP | 3.33 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide?
The IUPAC name of (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide (CID 119694692) is (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide.
What is the SMILES notation for (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide?
The canonical SMILES for (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide is CCc1oc2ccccc2c1CN(C)C(=O)[C@@H](N)CC(C)C.
What is the InChIKey of (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide?
The InChIKey is JICDNUIJFXRFME-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H26N2O2/c1-5-16-14(13-8-6-7-9-17(13)22-16)11-20(4)18(21)15(19)10-12(2)3/h6-9,12,15H,5,10-11,19H2,1-4H3/t15-/m0/s1.
What are the key properties of (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide?
(2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide has a molecular weight of 302.42 g/mol, XLogP of 3.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(2-ethyl-1-benzofuran-3-yl)methyl]-N,4-dimethylpentanamide is sourced from PubChem (CID 119694692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).