C12H24ClN3O3 — CID 119694990
3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119694990) has the molecular formula C12H24ClN3O3 and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119694990 |
| Molecular Formula | C12H24ClN3O3 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 3-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | COCCNC(=O)CNC(=O)C1CCCC(N)C1.Cl |
| InChI | InChI=1S/C12H23N3O3.ClH/c1-18-6-5-14-11(16)8-15-12(17)9-3-2-4-10(13)7-9;/h9-10H,2-8,13H2,1H3,(H,14,16)(H,15,17);1H |
| InChIKey | DBGPMBBJEKVGGV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|