About N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide
N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 11969637) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide |
| PubChem CID | 11969637 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C/C=C(\C)[C@H](O)C(COCc1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO4S/c1-4-17(3)21(23)20(15-26-14-18-8-6-5-7-9-18)22-27(24,25)19-12-10-16(2)11-13-19/h4-13,20-23H,14-15H2,1-3H3/b17-4+/t20?,21-/m0/s1 |
| InChIKey | ADTASHKDLUWEPQ-JVTRWDMYSA-N |
| XLogP | 3.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide (CID 11969637) is N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide is C/C=C(\C)[C@H](O)C(COCc1ccccc1)NS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide?
The InChIKey is ADTASHKDLUWEPQ-JVTRWDMYSA-N. The full InChI is InChI=1S/C21H27NO4S/c1-4-17(3)21(23)20(15-26-14-18-8-6-5-7-9-18)22-27(24,25)19-12-10-16(2)11-13-19/h4-13,20-23H,14-15H2,1-3H3/b17-4+/t20?,21-/m0/s1.
What are the key properties of N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide?
N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide has a molecular weight of 389.52 g/mol, XLogP of 3.19, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,3S)-3-hydroxy-4-methyl-1-phenylmethoxyhex-4-en-2-yl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 11969637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).