C13H25ClN2O — CID 119696948
3-amino-N-cyclopentyl-N-methylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 119696948) has the molecular formula C13H25ClN2O and a molecular weight of 260.81 g/mol. Its IUPAC name is 3-amino-N-cyclopentyl-N-methylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-cyclopentyl-N-methylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119696948 |
| Molecular Formula | C13H25ClN2O |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-amino-N-cyclopentyl-N-methylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CN(C(=O)C1CCCC(N)C1)C1CCCC1.Cl |
| InChI | InChI=1S/C13H24N2O.ClH/c1-15(12-7-2-3-8-12)13(16)10-5-4-6-11(14)9-10;/h10-12H,2-9,14H2,1H3;1H |
| InChIKey | RGVUGBXSNLTIPN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |