C21H24N2O3 — CID 119697137
3-amino-N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]benzamide (PubChem CID 119697137) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-amino-N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]benzamide.
| Compound Name | 3-amino-N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 119697137 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-amino-N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]benzamide |
| SMILES | Nc1cccc(C(=O)NCC2(c3ccc4c(c3)OCCO4)CCCC2)c1 |
| InChI | InChI=1S/C21H24N2O3/c22-17-5-3-4-15(12-17)20(24)23-14-21(8-1-2-9-21)16-6-7-18-19(13-16)26-11-10-25-18/h3-7,12-13H,1-2,8-11,14,22H2,(H,23,24) |
| InChIKey | DNUXAXGRYKJQTA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|