C11H16BrCl3 — CID 11969767
(1R,2R,4S,5S)-1-(bromomethyl)-2,4-dichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane (PubChem CID 11969767) has the molecular formula C11H16BrCl3 and a molecular weight of 334.51 g/mol. Its IUPAC name is (1R,2R,4S,5S)-1-(bromomethyl)-2,4-dichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane.
| Compound Name | (1R,2R,4S,5S)-1-(bromomethyl)-2,4-dichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 11969767 |
| Molecular Formula | C11H16BrCl3 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | (1R,2R,4S,5S)-1-(bromomethyl)-2,4-dichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane |
| SMILES | C[C@@]1(CBr)C[C@@](C)(/C=C/Cl)[C@@H](Cl)C[C@H]1Cl |
| InChI | InChI=1S/C11H16BrCl3/c1-10(3-4-13)6-11(2,7-12)9(15)5-8(10)14/h3-4,8-9H,5-7H2,1-2H3/b4-3+/t8-,9+,10+,11-/m0/s1 |
| InChIKey | VDVCNFRFKYYHRW-NRSUCWCISA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|