C13H18NO2P — CID 11969812
(2S,4S,5R)-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2lambda5-oxazaphospholidine 2-oxide (PubChem CID 11969812) has the molecular formula C13H18NO2P and a molecular weight of 251.27 g/mol. Its IUPAC name is (2S,4S,5R)-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2lambda5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4S,5R)-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2lambda5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 11969812 |
| Molecular Formula | C13H18NO2P |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2S,4S,5R)-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2lambda5-oxazaphospholidine 2-oxide |
| SMILES | C=CC[P@]1(=O)O[C@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C13H18NO2P/c1-4-10-17(15)14(3)11(2)13(16-17)12-8-6-5-7-9-12/h4-9,11,13H,1,10H2,2-3H3/t11-,13-,17-/m0/s1 |
| InChIKey | MYGKXPFVVGVJJU-BNLOLNQZSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|