C14H16ClN3OS — CID 119698331
3-amino-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 119698331) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 3-amino-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 3-amino-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 119698331 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-amino-N-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | CC(N)CC(=O)Nc1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-9(16)6-13(19)18-14-17-8-11(20-14)7-10-4-2-3-5-12(10)15/h2-5,8-9H,6-7,16H2,1H3,(H,17,18,19) |
| InChIKey | XISVLECUNKJXGY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |