C16H23ClN4O2 — CID 119700611
2-(2-methoxyethylamino)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide;hydrochloride (PubChem CID 119700611) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119700611 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCCc1cnn(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C16H22N4O2.ClH/c1-22-10-9-17-12-16(21)18-8-7-14-11-19-20(13-14)15-5-3-2-4-6-15;/h2-6,11,13,17H,7-10,12H2,1H3,(H,18,21);1H |
| InChIKey | OSOBUZJNXBVPNK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|