About 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde
2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde (PubChem CID 11970093) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde |
| PubChem CID | 11970093 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde |
| SMILES | O=CC[C@]12CC(=O)OC(C=CC13OCCO3)C2 |
| InChI | InChI=1S/C12H14O5/c13-4-3-11-7-9(17-10(14)8-11)1-2-12(11)15-5-6-16-12/h1-2,4,9H,3,5-8H2/t9?,11-/m0/s1 |
| InChIKey | AFKOMRXSQSJKJL-UMJHXOGRSA-N |
| XLogP | 0.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde?
The IUPAC name of 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde (CID 11970093) is 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde.
What is the SMILES notation for 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde?
The canonical SMILES for 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde is O=CC[C@]12CC(=O)OC(C=CC13OCCO3)C2.
What is the InChIKey of 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde?
The InChIKey is AFKOMRXSQSJKJL-UMJHXOGRSA-N. The full InChI is InChI=1S/C12H14O5/c13-4-3-11-7-9(17-10(14)8-11)1-2-12(11)15-5-6-16-12/h1-2,4,9H,3,5-8H2/t9?,11-/m0/s1.
What are the key properties of 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde?
2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde has a molecular weight of 238.24 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5'R)-3'-oxospiro[1,3-dioxolane-2,6'-2-oxabicyclo[3.3.1]non-7-ene]-5'-yl]acetaldehyde is sourced from PubChem (CID 11970093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).