C17H25N3O2 — CID 119701241
2-methyl-N-[4-[[(2-pyrrolidin-2-ylacetyl)amino]methyl]phenyl]propanamide (PubChem CID 119701241) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-methyl-N-[4-[[(2-pyrrolidin-2-ylacetyl)amino]methyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[(2-pyrrolidin-2-ylacetyl)amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 119701241 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-methyl-N-[4-[[(2-pyrrolidin-2-ylacetyl)amino]methyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(CNC(=O)CC2CCCN2)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-12(2)17(22)20-14-7-5-13(6-8-14)11-19-16(21)10-15-4-3-9-18-15/h5-8,12,15,18H,3-4,9-11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | JUNCIIJJPBRAEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |