C16H25F3N2O — CID 119701811
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 119701811) has the molecular formula C16H25F3N2O and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 119701811 |
| Molecular Formula | C16H25F3N2O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CC1CC2CCC(C1)N2)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H25F3N2O/c17-16(18,19)11-1-3-12(4-2-11)21-15(22)9-10-7-13-5-6-14(8-10)20-13/h10-14,20H,1-9H2,(H,21,22) |
| InChIKey | JXVOYYOSUZGRNP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |