C20H24N10O8PtSe2 — CID 11970192
bis(2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-selenolate);platinum(2+) (PubChem CID 11970192) has the molecular formula C20H24N10O8PtSe2 and a molecular weight of 885.47 g/mol. Its IUPAC name is bis(2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-selenolate);platinum(2+).
| Compound Name | bis(2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-selenolate);platinum(2+) |
|---|---|
| PubChem CID | 11970192 |
| Molecular Formula | C20H24N10O8PtSe2 |
| Molecular Weight | 885.47 g/mol |
| Exact Mass | 886.98 |
| IUPAC Name | bis(2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-selenolate);platinum(2+) |
| SMILES | Nc1nc([Se-])c2ncn(C3OC(CO)C(O)C3O)c2n1.Nc1nc([Se-])c2ncn(C3OC(CO)C(O)C3O)c2n1.[Pt+2] |
| InChI | InChI=1S/2C10H13N5O4Se.Pt/c2*11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;/h2*2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20);/q;;+2/p-2 |
| InChIKey | MHMICAZQRNCLDV-UHFFFAOYSA-L |
| XLogP | -6.37 |
| TPSA | 279.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.47 |
| LogP ≤ 5 | -6.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|