C14H19ClN4O — CID 119702362
2-methyl-3-(methylamino)-N-(4-pyrazol-1-ylphenyl)propanamide;hydrochloride (PubChem CID 119702362) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(4-pyrazol-1-ylphenyl)propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(4-pyrazol-1-ylphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119702362 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(4-pyrazol-1-ylphenyl)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1ccc(-n2cccn2)cc1.Cl |
| InChI | InChI=1S/C14H18N4O.ClH/c1-11(10-15-2)14(19)17-12-4-6-13(7-5-12)18-9-3-8-16-18;/h3-9,11,15H,10H2,1-2H3,(H,17,19);1H |
| InChIKey | SJFYVWLYUZKDIR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |