C17H26ClN3O2 — CID 119703073
(2R)-N-[4-(tert-butylcarbamoyl)phenyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119703073) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is (2R)-N-[4-(tert-butylcarbamoyl)phenyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[4-(tert-butylcarbamoyl)phenyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119703073 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R)-N-[4-(tert-butylcarbamoyl)phenyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CC(C)(C)NC(=O)c1ccc(NC(=O)[C@H]2CCCCN2)cc1.Cl |
| InChI | InChI=1S/C17H25N3O2.ClH/c1-17(2,3)20-15(21)12-7-9-13(10-8-12)19-16(22)14-6-4-5-11-18-14;/h7-10,14,18H,4-6,11H2,1-3H3,(H,19,22)(H,20,21);1H/t14-;/m1./s1 |
| InChIKey | JGYXFAFXHONNKC-PFEQFJNWSA-N |
| XLogP | 2.72 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |