C14H21Cl2N3O2 — CID 119703400
4-chloro-N-[2-[4-(methylamino)butanoylamino]ethyl]benzamide;hydrochloride (PubChem CID 119703400) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-(methylamino)butanoylamino]ethyl]benzamide;hydrochloride.
| Compound Name | 4-chloro-N-[2-[4-(methylamino)butanoylamino]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119703400 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-chloro-N-[2-[4-(methylamino)butanoylamino]ethyl]benzamide;hydrochloride |
| SMILES | CNCCCC(=O)NCCNC(=O)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C14H20ClN3O2.ClH/c1-16-8-2-3-13(19)17-9-10-18-14(20)11-4-6-12(15)7-5-11;/h4-7,16H,2-3,8-10H2,1H3,(H,17,19)(H,18,20);1H |
| InChIKey | PQODOVYBFFGMCK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|