C17H23Cl2N3O2 — CID 119704945
2-amino-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-2-methylpentan-1-one (PubChem CID 119704945) has the molecular formula C17H23Cl2N3O2 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-amino-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-2-methylpentan-1-one.
| Compound Name | 2-amino-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 119704945 |
| Molecular Formula | C17H23Cl2N3O2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-amino-1-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-2-methylpentan-1-one |
| SMILES | CCCC(C)(N)C(=O)N1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23Cl2N3O2/c1-3-4-17(2,20)16(24)22-7-5-21(6-8-22)15(23)12-9-13(18)11-14(19)10-12/h9-11H,3-8,20H2,1-2H3 |
| InChIKey | RKBWDDCVMFEYLB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |