C15H20ClF3N2O — CID 119705497
3-amino-N-[[2-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119705497) has the molecular formula C15H20ClF3N2O and a molecular weight of 336.79 g/mol. Its IUPAC name is 3-amino-N-[[2-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[[2-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119705497 |
| Molecular Formula | C15H20ClF3N2O |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-amino-N-[[2-(trifluoromethyl)phenyl]methyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCCC(C(=O)NCc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H19F3N2O.ClH/c16-15(17,18)13-7-2-1-4-11(13)9-20-14(21)10-5-3-6-12(19)8-10;/h1-2,4,7,10,12H,3,5-6,8-9,19H2,(H,20,21);1H |
| InChIKey | XKXDZZGYECNWGB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |