C14H17ClF4N2O2 — CID 119705583
N-[2-fluoro-5-(trifluoromethyl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119705583) has the molecular formula C14H17ClF4N2O2 and a molecular weight of 356.75 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119705583 |
| Molecular Formula | C14H17ClF4N2O2 |
| Molecular Weight | 356.75 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)Nc2cc(C(F)(F)F)ccc2F)CCNCC1.Cl |
| InChI | InChI=1S/C14H16F4N2O2.ClH/c1-22-13(4-6-19-7-5-13)12(21)20-11-8-9(14(16,17)18)2-3-10(11)15;/h2-3,8,19H,4-7H2,1H3,(H,20,21);1H |
| InChIKey | AFYZDJUCOPFMBF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |