C15H24ClN3O2 — CID 119706304
N-[(3-acetamidophenyl)methyl]-2-amino-3-methylpentanamide;hydrochloride (PubChem CID 119706304) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is N-[(3-acetamidophenyl)methyl]-2-amino-3-methylpentanamide;hydrochloride.
| Compound Name | N-[(3-acetamidophenyl)methyl]-2-amino-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119706304 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-[(3-acetamidophenyl)methyl]-2-amino-3-methylpentanamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)NCc1cccc(NC(C)=O)c1.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-4-10(2)14(16)15(20)17-9-12-6-5-7-13(8-12)18-11(3)19;/h5-8,10,14H,4,9,16H2,1-3H3,(H,17,20)(H,18,19);1H |
| InChIKey | DKCLDPXUIJVUAF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |