About (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride
(5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride (PubChem CID 119706868) has the molecular formula C13H16BrClN2O2
and a molecular weight of 347.64 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride.
Molecular Properties
| Compound Name | (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride |
| PubChem CID | 119706868 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(C1CNCCO1)N1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H15BrN2O2.ClH/c14-10-1-2-11-9(7-10)3-5-16(11)13(17)12-8-15-4-6-18-12;/h1-2,7,12,15H,3-6,8H2;1H |
| InChIKey | JVTQZHLKKDDMDD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride?
The IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride (CID 119706868) is (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride.
What is the SMILES notation for (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride?
The canonical SMILES for (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride is Cl.O=C(C1CNCCO1)N1CCc2cc(Br)ccc21.
What is the InChIKey of (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride?
The InChIKey is JVTQZHLKKDDMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O2.ClH/c14-10-1-2-11-9(7-10)3-5-16(11)13(17)12-8-15-4-6-18-12;/h1-2,7,12,15H,3-6,8H2;1H.
What are the key properties of (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride?
(5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride has a molecular weight of 347.64 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydroindol-1-yl)-morpholin-2-ylmethanone;hydrochloride is sourced from PubChem (CID 119706868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).