C21H29ClN2O — CID 119707667
N-methyl-N-(naphthalen-1-ylmethyl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119707667) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is N-methyl-N-(naphthalen-1-ylmethyl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-methyl-N-(naphthalen-1-ylmethyl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119707667 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-methyl-N-(naphthalen-1-ylmethyl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(C)Cc1cccc2ccccc12)C1CCCNC1.Cl |
| InChI | InChI=1S/C21H28N2O.ClH/c1-16(18-10-6-12-22-14-18)13-21(24)23(2)15-19-9-5-8-17-7-3-4-11-20(17)19;/h3-5,7-9,11,16,18,22H,6,10,12-15H2,1-2H3;1H |
| InChIKey | BQRYIGCUVMJEFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |