C15H21ClN2O3 — CID 119707961
methyl 2-phenyl-2-[(2-pyrrolidin-2-ylacetyl)amino]acetate;hydrochloride (PubChem CID 119707961) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 2-phenyl-2-[(2-pyrrolidin-2-ylacetyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-phenyl-2-[(2-pyrrolidin-2-ylacetyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 119707961 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 2-phenyl-2-[(2-pyrrolidin-2-ylacetyl)amino]acetate;hydrochloride |
| SMILES | COC(=O)C(NC(=O)CC1CCCN1)c1ccccc1.Cl |
| InChI | InChI=1S/C15H20N2O3.ClH/c1-20-15(19)14(11-6-3-2-4-7-11)17-13(18)10-12-8-5-9-16-12;/h2-4,6-7,12,14,16H,5,8-10H2,1H3,(H,17,18);1H |
| InChIKey | RBCMZIMGFMFLEC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |