C5H9N5O2 — CID 11970841
2-[(4,6-diamino-1,3,5-triazin-2-yl)oxy]ethanol (PubChem CID 11970841) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)oxy]ethanol.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 11970841 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)oxy]ethanol |
| SMILES | Nc1nc(N)nc(OCCO)n1 |
| InChI | InChI=1S/C5H9N5O2/c6-3-8-4(7)10-5(9-3)12-2-1-11/h11H,1-2H2,(H4,6,7,8,9,10) |
| InChIKey | NNGSAOWVXUXCDK-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |