C19H28N2OS — CID 119708943
1-(3-phenylthiomorpholin-4-yl)-3-piperidin-4-ylbutan-1-one (PubChem CID 119708943) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-(3-phenylthiomorpholin-4-yl)-3-piperidin-4-ylbutan-1-one.
| Compound Name | 1-(3-phenylthiomorpholin-4-yl)-3-piperidin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 119708943 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-(3-phenylthiomorpholin-4-yl)-3-piperidin-4-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCSCC1c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C19H28N2OS/c1-15(16-7-9-20-10-8-16)13-19(22)21-11-12-23-14-18(21)17-5-3-2-4-6-17/h2-6,15-16,18,20H,7-14H2,1H3 |
| InChIKey | WSEWWXGZDGIMQI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |