C16H21ClN2O — CID 119709567
2-methyl-3-(methylamino)-N-(naphthalen-1-ylmethyl)propanamide;hydrochloride (PubChem CID 119709567) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(naphthalen-1-ylmethyl)propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(naphthalen-1-ylmethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119709567 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(naphthalen-1-ylmethyl)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NCc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C16H20N2O.ClH/c1-12(10-17-2)16(19)18-11-14-8-5-7-13-6-3-4-9-15(13)14;/h3-9,12,17H,10-11H2,1-2H3,(H,18,19);1H |
| InChIKey | UDKSUCJBALIPED-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |