About 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione
3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione (PubChem CID 11971074) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione.
Molecular Properties
| Compound Name | 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione |
| PubChem CID | 11971074 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione |
| SMILES | CCCC1(C)COC(=O)N(C)C1=O |
| InChI | InChI=1S/C9H15NO3/c1-4-5-9(2)6-13-8(12)10(3)7(9)11/h4-6H2,1-3H3 |
| InChIKey | STTOVGOOTSKACO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione?
The IUPAC name of 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione (CID 11971074) is 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione.
What is the SMILES notation for 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione?
The canonical SMILES for 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione is CCCC1(C)COC(=O)N(C)C1=O.
What is the InChIKey of 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione?
The InChIKey is STTOVGOOTSKACO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-4-5-9(2)6-13-8(12)10(3)7(9)11/h4-6H2,1-3H3.
What are the key properties of 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione?
3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione has a molecular weight of 185.22 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-5-propyl-1,3-oxazinane-2,4-dione is sourced from PubChem (CID 11971074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).